C41H67N3S3+2 — CID 46868895
4-methyl-2-[(1E,3Z,5Z)-1-(5-methyl-3-octyl-1,3-thiazol-3-ium-2-yl)-5-(4-methyl-3-octyl-1,3-thiazol-2-ylidene)penta-1,3-dien-3-yl]-3-octyl-1,3-thiazol-3-ium (PubChem CID 46868895) has the molecular formula C41H67N3S3+2 and a molecular weight of 698.21 g/mol. Its IUPAC name is 4-methyl-2-[(1E,3Z,5Z)-1-(5-methyl-3-octyl-1,3-thiazol-3-ium-2-yl)-5-(4-methyl-3-octyl-1,3-thiazol-2-ylidene)penta-1,3-dien-3-yl]-3-octyl-1,3-thiazol-3-ium.
| Compound Name | 4-methyl-2-[(1E,3Z,5Z)-1-(5-methyl-3-octyl-1,3-thiazol-3-ium-2-yl)-5-(4-methyl-3-octyl-1,3-thiazol-2-ylidene)penta-1,3-dien-3-yl]-3-octyl-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 46868895 |
| Molecular Formula | C41H67N3S3+2 |
| Molecular Weight | 698.21 g/mol |
| Exact Mass | 697.45 |
| IUPAC Name | 4-methyl-2-[(1E,3Z,5Z)-1-(5-methyl-3-octyl-1,3-thiazol-3-ium-2-yl)-5-(4-methyl-3-octyl-1,3-thiazol-2-ylidene)penta-1,3-dien-3-yl]-3-octyl-1,3-thiazol-3-ium |
| SMILES | CCCCCCCCN1C(C)=CS/C1=C\C=C(\C=C\c1sc(C)c[n+]1CCCCCCCC)c1scc(C)[n+]1CCCCCCCC |
| InChI | InChI=1S/C41H67N3S3/c1-7-10-13-16-19-22-29-42-32-37(6)47-39(42)27-25-38(41-44(36(5)34-46-41)31-24-21-18-15-12-9-3)26-28-40-43(35(4)33-45-40)30-23-20-17-14-11-8-2/h25-28,32-34H,7-24,29-31H2,1-6H3/q+2 |
| InChIKey | SKAGLGDTMWACKM-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 11.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.21 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|