C28H45IN2O2S2 — CID 88728589
ethyl 3-heptyl-2-[3-(3-heptyl-4-methyl-1,3-thiazol-2-ylidene)prop-1-enyl]-4-methyl-1,3-thiazol-3-ium-5-carboxylate iodide (PubChem CID 88728589) has the molecular formula C28H45IN2O2S2 and a molecular weight of 632.72 g/mol. Its IUPAC name is ethyl 3-heptyl-2-[3-(3-heptyl-4-methyl-1,3-thiazol-2-ylidene)prop-1-enyl]-4-methyl-1,3-thiazol-3-ium-5-carboxylate iodide.
| Compound Name | ethyl 3-heptyl-2-[3-(3-heptyl-4-methyl-1,3-thiazol-2-ylidene)prop-1-enyl]-4-methyl-1,3-thiazol-3-ium-5-carboxylate iodide |
|---|---|
| PubChem CID | 88728589 |
| Molecular Formula | C28H45IN2O2S2 |
| Molecular Weight | 632.72 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | ethyl 3-heptyl-2-[3-(3-heptyl-4-methyl-1,3-thiazol-2-ylidene)prop-1-enyl]-4-methyl-1,3-thiazol-3-ium-5-carboxylate iodide |
| SMILES | CCCCCCCN1C(C)=CSC1=CC=Cc1sc(C(=O)OCC)c(C)[n+]1CCCCCCC.[I-] |
| InChI | InChI=1S/C28H45N2O2S2.HI/c1-6-9-11-13-15-20-29-23(4)22-33-25(29)18-17-19-26-30(21-16-14-12-10-7-2)24(5)27(34-26)28(31)32-8-3;/h17-19,22H,6-16,20-21H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | FHXKGRPMQZRYSG-UHFFFAOYSA-M |
| XLogP | 5.23 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.72 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|