C38H61N3S3+2 — CID 4859
2-[3,5-bis(3-heptyl-4-methyl-1,3-thiazol-3-ium-2-yl)penta-2,4-dienylidene]-3-heptyl-4-methyl-1,3-thiazole (PubChem CID 4859) has the molecular formula C38H61N3S3+2 and a molecular weight of 656.13 g/mol. Its IUPAC name is 2-[3,5-bis(3-heptyl-4-methyl-1,3-thiazol-3-ium-2-yl)penta-2,4-dienylidene]-3-heptyl-4-methyl-1,3-thiazole.
| Compound Name | 2-[3,5-bis(3-heptyl-4-methyl-1,3-thiazol-3-ium-2-yl)penta-2,4-dienylidene]-3-heptyl-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 4859 |
| Molecular Formula | C38H61N3S3+2 |
| Molecular Weight | 656.13 g/mol |
| Exact Mass | 655.40 |
| IUPAC Name | 2-[3,5-bis(3-heptyl-4-methyl-1,3-thiazol-3-ium-2-yl)penta-2,4-dienylidene]-3-heptyl-4-methyl-1,3-thiazole |
| SMILES | CCCCCCCN1C(C)=CSC1=CC=C(C=Cc1scc(C)[n+]1CCCCCCC)c1scc(C)[n+]1CCCCCCC |
| InChI | InChI=1S/C38H61N3S3/c1-7-10-13-16-19-26-39-32(4)29-42-36(39)24-22-35(38-41(34(6)31-44-38)28-21-18-15-12-9-3)23-25-37-40(33(5)30-43-37)27-20-17-14-11-8-2/h22-25,29-31H,7-21,26-28H2,1-6H3/q+2 |
| InChIKey | FKFUHAJJKUCVRF-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 11.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.13 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|