C43H68O11 — CID 76723967
4-O-[21-[4-(2-methoxyethoxy)-4-oxobutanoyl]oxyhexacosa-1,9,17,25-tetraen-5-yl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate (PubChem CID 76723967) has the molecular formula C43H68O11 and a molecular weight of 761.01 g/mol. Its IUPAC name is 4-O-[21-[4-(2-methoxyethoxy)-4-oxobutanoyl]oxyhexacosa-1,9,17,25-tetraen-5-yl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate.
| Compound Name | 4-O-[21-[4-(2-methoxyethoxy)-4-oxobutanoyl]oxyhexacosa-1,9,17,25-tetraen-5-yl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate |
|---|---|
| PubChem CID | 76723967 |
| Molecular Formula | C43H68O11 |
| Molecular Weight | 761.01 g/mol |
| Exact Mass | 760.48 |
| IUPAC Name | 4-O-[21-[4-(2-methoxyethoxy)-4-oxobutanoyl]oxyhexacosa-1,9,17,25-tetraen-5-yl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate |
| SMILES | C=CCCCC(CCC=CCCCCCCC=CCCCC(CCC=C)OC(=O)CCC(=O)OCCOC(=O)C(=C)C)OC(=O)CCC(=O)OCCOC |
| InChI | InChI=1S/C43H68O11/c1-6-8-21-25-38(54-42(47)30-28-39(44)50-33-32-49-5)27-23-20-18-16-14-12-10-11-13-15-17-19-22-26-37(24-9-7-2)53-41(46)31-29-40(45)51-34-35-52-43(48)36(3)4/h6-7,15,17-18,20,37-38H,1-3,8-14,16,19,21-35H2,4-5H3 |
| InChIKey | OXLFMAXKFWFGAD-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.01 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|