C23H26N6OS — CID 76760519
4-[3-methyl-4-[(9-oxo-12-thia-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl)methyl]piperazin-1-yl]benzonitrile (PubChem CID 76760519) has the molecular formula C23H26N6OS and a molecular weight of 434.57 g/mol. Its IUPAC name is 4-[3-methyl-4-[(9-oxo-12-thia-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl)methyl]piperazin-1-yl]benzonitrile.
| Compound Name | 4-[3-methyl-4-[(9-oxo-12-thia-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl)methyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 76760519 |
| Molecular Formula | C23H26N6OS |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 4-[3-methyl-4-[(9-oxo-12-thia-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl)methyl]piperazin-1-yl]benzonitrile |
| SMILES | CC1CN(c2ccc(C#N)cc2)CCN1Cc1cnc2c(c1)NC(=O)C1CSCCN21 |
| InChI | InChI=1S/C23H26N6OS/c1-16-13-28(19-4-2-17(11-24)3-5-19)7-6-27(16)14-18-10-20-22(25-12-18)29-8-9-31-15-21(29)23(30)26-20/h2-5,10,12,16,21H,6-9,13-15H2,1H3,(H,26,30) |
| InChIKey | YDFHXXPSBXGPSG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |