C12H12ClF3N2O5S — CID 7677660
5-chloro-3-methyl-2-oxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-benzoxazole-6-sulfonamide (PubChem CID 7677660) has the molecular formula C12H12ClF3N2O5S and a molecular weight of 388.75 g/mol. Its IUPAC name is 5-chloro-3-methyl-2-oxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-benzoxazole-6-sulfonamide.
| Compound Name | 5-chloro-3-methyl-2-oxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 7677660 |
| Molecular Formula | C12H12ClF3N2O5S |
| Molecular Weight | 388.75 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 5-chloro-3-methyl-2-oxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-benzoxazole-6-sulfonamide |
| SMILES | Cn1c(=O)oc2cc(S(=O)(=O)NCCOCC(F)(F)F)c(Cl)cc21 |
| InChI | InChI=1S/C12H12ClF3N2O5S/c1-18-8-4-7(13)10(5-9(8)23-11(18)19)24(20,21)17-2-3-22-6-12(14,15)16/h4-5,17H,2-3,6H2,1H3 |
| InChIKey | SKGPDFQRQQNGJS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.75 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|