C13H25N3OS — CID 7689651
1-(2-methoxyethyl)-3-[(Z)-[(5S)-3,3,5-trimethylcyclohexylidene]amino]thiourea (PubChem CID 7689651) has the molecular formula C13H25N3OS and a molecular weight of 271.43 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[(Z)-[(5S)-3,3,5-trimethylcyclohexylidene]amino]thiourea.
| Compound Name | 1-(2-methoxyethyl)-3-[(Z)-[(5S)-3,3,5-trimethylcyclohexylidene]amino]thiourea |
|---|---|
| PubChem CID | 7689651 |
| Molecular Formula | C13H25N3OS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[(Z)-[(5S)-3,3,5-trimethylcyclohexylidene]amino]thiourea |
| SMILES | COCCNC(=S)N/N=C1/C[C@@H](C)CC(C)(C)C1 |
| InChI | InChI=1S/C13H25N3OS/c1-10-7-11(9-13(2,3)8-10)15-16-12(18)14-5-6-17-4/h10H,5-9H2,1-4H3,(H2,14,16,18)/b15-11-/t10-/m1/s1 |
| InChIKey | XNRQGFRCISDTHB-BXSDCGNMSA-N |
| XLogP | 2.30 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|