C16H18F3N3O4S — CID 76901923
N-[3-[(4aS,7aS)-3-amino-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-4a-yl]-4-fluorophenyl]-2,2-difluoroacetamide (PubChem CID 76901923) has the molecular formula C16H18F3N3O4S and a molecular weight of 405.40 g/mol. Its IUPAC name is N-[3-[(4aS,7aS)-3-amino-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-4a-yl]-4-fluorophenyl]-2,2-difluoroacetamide.
| Compound Name | N-[3-[(4aS,7aS)-3-amino-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-4a-yl]-4-fluorophenyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 76901923 |
| Molecular Formula | C16H18F3N3O4S |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-[3-[(4aS,7aS)-3-amino-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-4a-yl]-4-fluorophenyl]-2,2-difluoroacetamide |
| SMILES | CC1(C)C(N)=N[C@@]2(c3cc(NC(=O)C(F)F)ccc3F)COC[C@H]2S1(=O)=O |
| InChI | InChI=1S/C16H18F3N3O4S/c1-15(2)14(20)22-16(7-26-6-11(16)27(15,24)25)9-5-8(3-4-10(9)17)21-13(23)12(18)19/h3-5,11-12H,6-7H2,1-2H3,(H2,20,22)(H,21,23)/t11-,16-/m1/s1 |
| InChIKey | OLHNQUAKOSLLLA-BDJLRTHQSA-N |
| XLogP | 1.19 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |