C16H21F2N3O4S — CID 66563057
N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-2-methoxyacetamide (PubChem CID 66563057) has the molecular formula C16H21F2N3O4S and a molecular weight of 389.42 g/mol. Its IUPAC name is N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-2-methoxyacetamide.
| Compound Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 66563057 |
| Molecular Formula | C16H21F2N3O4S |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1cc(F)c(F)c([C@]2(C)CS(=O)(=O)C(C)(C)C(N)=N2)c1 |
| InChI | InChI=1S/C16H21F2N3O4S/c1-15(2)14(19)21-16(3,8-26(15,23)24)10-5-9(6-11(17)13(10)18)20-12(22)7-25-4/h5-6H,7-8H2,1-4H3,(H2,19,21)(H,20,22)/t16-/m0/s1 |
| InChIKey | MOQYEOMDROTSCP-INIZCTEOSA-N |
| XLogP | 1.33 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |