C11H21N3O4S — CID 76920246
N-(1,1-dioxothiolan-3-yl)-2-ethyl-2-(N'-hydroxycarbamimidoyl)butanamide (PubChem CID 76920246) has the molecular formula C11H21N3O4S and a molecular weight of 291.37 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-ethyl-2-(N'-hydroxycarbamimidoyl)butanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-ethyl-2-(N'-hydroxycarbamimidoyl)butanamide |
|---|---|
| PubChem CID | 76920246 |
| Molecular Formula | C11H21N3O4S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-ethyl-2-(N'-hydroxycarbamimidoyl)butanamide |
| SMILES | CCC(CC)(C(=O)NC1CCS(=O)(=O)C1)C(N)=NO |
| InChI | InChI=1S/C11H21N3O4S/c1-3-11(4-2,9(12)14-16)10(15)13-8-5-6-19(17,18)7-8/h8,16H,3-7H2,1-2H3,(H2,12,14)(H,13,15) |
| InChIKey | WLNPNMREPQCWLK-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 121.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|