C10H16N2O3S — CID 114290964
2-cyano-N-(1,1-dioxothiolan-3-yl)-2-methylbutanamide (PubChem CID 114290964) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is 2-cyano-N-(1,1-dioxothiolan-3-yl)-2-methylbutanamide.
| Compound Name | 2-cyano-N-(1,1-dioxothiolan-3-yl)-2-methylbutanamide |
|---|---|
| PubChem CID | 114290964 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2-cyano-N-(1,1-dioxothiolan-3-yl)-2-methylbutanamide |
| SMILES | CCC(C)(C#N)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H16N2O3S/c1-3-10(2,7-11)9(13)12-8-4-5-16(14,15)6-8/h8H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | NVBXCXBESMJNGC-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |