C16H19N — CID 76974312
2,2-dideuterio-N,N-dimethyl-2-(2,3,4,5,6-pentadeuteriophenyl)-1-phenylethanamine (PubChem CID 76974312) has the molecular formula C16H19N and a molecular weight of 232.38 g/mol. Its IUPAC name is 2,2-dideuterio-N,N-dimethyl-2-(2,3,4,5,6-pentadeuteriophenyl)-1-phenylethanamine.
| Compound Name | 2,2-dideuterio-N,N-dimethyl-2-(2,3,4,5,6-pentadeuteriophenyl)-1-phenylethanamine |
|---|---|
| PubChem CID | 76974312 |
| Molecular Formula | C16H19N |
| Molecular Weight | 232.38 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | 2,2-dideuterio-N,N-dimethyl-2-(2,3,4,5,6-pentadeuteriophenyl)-1-phenylethanamine |
| SMILES | [2H]c1c([2H])c([2H])c(C([2H])([2H])C(c2ccccc2)N(C)C)c([2H])c1[2H] |
| InChI | InChI=1S/C16H19N/c1-17(2)16(15-11-7-4-8-12-15)13-14-9-5-3-6-10-14/h3-12,16H,13H2,1-2H3/i3D,5D,6D,9D,10D,13D2 |
| InChIKey | YEJZJVJJPVZXGX-IRWJWAKBSA-N |
| XLogP | 3.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |