C16H12Cl3NO3 — CID 7701444
(Z)-N-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-1-(2,3-dichlorophenyl)methanimine (PubChem CID 7701444) has the molecular formula C16H12Cl3NO3 and a molecular weight of 372.64 g/mol. Its IUPAC name is (Z)-N-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-1-(2,3-dichlorophenyl)methanimine.
| Compound Name | (Z)-N-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-1-(2,3-dichlorophenyl)methanimine |
|---|---|
| PubChem CID | 7701444 |
| Molecular Formula | C16H12Cl3NO3 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | (Z)-N-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-1-(2,3-dichlorophenyl)methanimine |
| SMILES | Clc1cc2c(c(CO/N=C\c3cccc(Cl)c3Cl)c1)OCOC2 |
| InChI | InChI=1S/C16H12Cl3NO3/c17-13-4-11-7-21-9-22-16(11)12(5-13)8-23-20-6-10-2-1-3-14(18)15(10)19/h1-6H,7-9H2/b20-6- |
| InChIKey | UGNGSOURBBOYFI-IOXNKQMXSA-N |
| XLogP | 5.06 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|