C14H18N2O4 — CID 77070732
2-[1-(1,3-benzodioxol-5-ylmethoxymethyl)cyclopropyl]-N'-hydroxyethanimidamide (PubChem CID 77070732) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[1-(1,3-benzodioxol-5-ylmethoxymethyl)cyclopropyl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[1-(1,3-benzodioxol-5-ylmethoxymethyl)cyclopropyl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 77070732 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-[1-(1,3-benzodioxol-5-ylmethoxymethyl)cyclopropyl]-N'-hydroxyethanimidamide |
| SMILES | NC(CC1(COCc2ccc3c(c2)OCO3)CC1)=NO |
| InChI | InChI=1S/C14H18N2O4/c15-13(16-17)6-14(3-4-14)8-18-7-10-1-2-11-12(5-10)20-9-19-11/h1-2,5,17H,3-4,6-9H2,(H2,15,16) |
| InChIKey | HZDABHTZZVMQCO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|