C49H72N4O5 — CID 771
3-[18-(2-carboxyethyl)-13-ethenyl-8-(1-hydroxy-5,9,13-trimethyltetradeca-4,8,12-trienyl)-3,7,12,17-tetramethyl-1,2,3,6,7,8,9,12,17,18,21,22,23,24-tetradecahydroporphyrin-2-yl]propanoic acid (PubChem CID 771) has the molecular formula C49H72N4O5 and a molecular weight of 797.14 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-13-ethenyl-8-(1-hydroxy-5,9,13-trimethyltetradeca-4,8,12-trienyl)-3,7,12,17-tetramethyl-1,2,3,6,7,8,9,12,17,18,21,22,23,24-tetradecahydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-(2-carboxyethyl)-13-ethenyl-8-(1-hydroxy-5,9,13-trimethyltetradeca-4,8,12-trienyl)-3,7,12,17-tetramethyl-1,2,3,6,7,8,9,12,17,18,21,22,23,24-tetradecahydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 771 |
| Molecular Formula | C49H72N4O5 |
| Molecular Weight | 797.14 g/mol |
| Exact Mass | 796.55 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-13-ethenyl-8-(1-hydroxy-5,9,13-trimethyltetradeca-4,8,12-trienyl)-3,7,12,17-tetramethyl-1,2,3,6,7,8,9,12,17,18,21,22,23,24-tetradecahydroporphyrin-2-yl]propanoic acid |
| SMILES | C=CC1=C2C=C3NC(=CC4NC(=CC5NC(C=C(N2)C1C)C(C(O)CCC=C(C)CCC=C(C)CCC=C(C)C)C5C)C(C)C4CCC(=O)O)C(CCC(=O)O)C3C |
| InChI | InChI=1S/C49H72N4O5/c1-10-35-31(6)40-26-45-49(46(54)19-13-18-30(5)17-12-16-29(4)15-11-14-28(2)3)34(9)41(53-45)24-38-32(7)36(20-22-47(55)56)43(51-38)27-44-37(21-23-48(57)58)33(8)39(52-44)25-42(35)50-40/h10,14,16,18,24-27,31-34,36-37,41,43,45-46,49-54H,1,11-13,15,17,19-23H2,2-9H3,(H,55,56)(H,57,58) |
| InChIKey | QDWRZFOSFZXXTP-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 142.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.14 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|