About 2-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride
2-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride (PubChem CID 77214893) has the molecular formula C8H11ClFNO4
and a molecular weight of 239.63 g/mol. Its IUPAC name is 2-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride |
| PubChem CID | 77214893 |
| Molecular Formula | C8H11ClFNO4 |
| Molecular Weight | 239.63 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 2-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride |
| SMILES | Cl.NC1(C(=O)O)CC(F)C2C(C(=O)O)C21 |
| InChI | InChI=1S/C8H10FNO4.ClH/c9-2-1-8(10,7(13)14)5-3(2)4(5)6(11)12;/h2-5H,1,10H2,(H,11,12)(H,13,14);1H |
| InChIKey | SKUQLNUMXDHBGE-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.63 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride?
The IUPAC name of 2-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride (CID 77214893) is 2-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride.
What is the SMILES notation for 2-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride?
The canonical SMILES for 2-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride is Cl.NC1(C(=O)O)CC(F)C2C(C(=O)O)C21.
What is the InChIKey of 2-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride?
The InChIKey is SKUQLNUMXDHBGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FNO4.ClH/c9-2-1-8(10,7(13)14)5-3(2)4(5)6(11)12;/h2-5H,1,10H2,(H,11,12)(H,13,14);1H.
What are the key properties of 2-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride?
2-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride has a molecular weight of 239.63 g/mol, XLogP of -0.12, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride is sourced from PubChem (CID 77214893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).