C45H40N2O4 — CID 77217540
1-N',1-N'-bis(2-hydroxy-1,2,2-triphenylethyl)cyclopropane-1,1-dicarboxamide (PubChem CID 77217540) has the molecular formula C45H40N2O4 and a molecular weight of 672.83 g/mol. Its IUPAC name is 1-N',1-N'-bis(2-hydroxy-1,2,2-triphenylethyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N',1-N'-bis(2-hydroxy-1,2,2-triphenylethyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 77217540 |
| Molecular Formula | C45H40N2O4 |
| Molecular Weight | 672.83 g/mol |
| Exact Mass | 672.30 |
| IUPAC Name | 1-N',1-N'-bis(2-hydroxy-1,2,2-triphenylethyl)cyclopropane-1,1-dicarboxamide |
| SMILES | NC(=O)C1(C(=O)N(C(c2ccccc2)C(O)(c2ccccc2)c2ccccc2)C(c2ccccc2)C(O)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C45H40N2O4/c46-41(48)43(31-32-43)42(49)47(39(33-19-7-1-8-20-33)44(50,35-23-11-3-12-24-35)36-25-13-4-14-26-36)40(34-21-9-2-10-22-34)45(51,37-27-15-5-16-28-37)38-29-17-6-18-30-38/h1-30,39-40,50-51H,31-32H2,(H2,46,48) |
| InChIKey | DYOLZDUGGJUHOA-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.83 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|