C17H18Cl2N2O2 — CID 77244474
1-[[6-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methyl]pyridin-2-one (PubChem CID 77244474) has the molecular formula C17H18Cl2N2O2 and a molecular weight of 353.25 g/mol. Its IUPAC name is 1-[[6-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methyl]pyridin-2-one.
| Compound Name | 1-[[6-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methyl]pyridin-2-one |
|---|---|
| PubChem CID | 77244474 |
| Molecular Formula | C17H18Cl2N2O2 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 1-[[6-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methyl]pyridin-2-one |
| SMILES | O=c1ccccn1CC1OCCNCC1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H18Cl2N2O2/c18-14-5-4-12(9-15(14)19)13-10-20-6-8-23-16(13)11-21-7-2-1-3-17(21)22/h1-5,7,9,13,16,20H,6,8,10-11H2 |
| InChIKey | AJGWZAYQRRJMHC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |