C22H26N8O2 — CID 77271223
13-(methylamino)-8-[3-[5-(propan-2-ylamino)-1,3,4-oxadiazol-2-yl]phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one (PubChem CID 77271223) has the molecular formula C22H26N8O2 and a molecular weight of 434.50 g/mol. Its IUPAC name is 13-(methylamino)-8-[3-[5-(propan-2-ylamino)-1,3,4-oxadiazol-2-yl]phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one.
| Compound Name | 13-(methylamino)-8-[3-[5-(propan-2-ylamino)-1,3,4-oxadiazol-2-yl]phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
|---|---|
| PubChem CID | 77271223 |
| Molecular Formula | C22H26N8O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 13-(methylamino)-8-[3-[5-(propan-2-ylamino)-1,3,4-oxadiazol-2-yl]phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
| SMILES | CNc1ncc2c(n1)N1CCCC1CN(c1cccc(-c3nnc(NC(C)C)o3)c1)C2=O |
| InChI | InChI=1S/C22H26N8O2/c1-13(2)25-22-28-27-19(32-22)14-6-4-7-15(10-14)30-12-16-8-5-9-29(16)18-17(20(30)31)11-24-21(23-3)26-18/h4,6-7,10-11,13,16H,5,8-9,12H2,1-3H3,(H,25,28)(H,23,24,26) |
| InChIKey | WSNIONPNJJDQDP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |