C12H14F3NO3S — CID 7792672
phenyl (3R)-3-(trifluoromethyl)piperidine-1-sulfonate (PubChem CID 7792672) has the molecular formula C12H14F3NO3S and a molecular weight of 309.31 g/mol. Its IUPAC name is phenyl (3R)-3-(trifluoromethyl)piperidine-1-sulfonate.
| Compound Name | phenyl (3R)-3-(trifluoromethyl)piperidine-1-sulfonate |
|---|---|
| PubChem CID | 7792672 |
| Molecular Formula | C12H14F3NO3S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | phenyl (3R)-3-(trifluoromethyl)piperidine-1-sulfonate |
| SMILES | O=S(=O)(Oc1ccccc1)N1CCC[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C12H14F3NO3S/c13-12(14,15)10-5-4-8-16(9-10)20(17,18)19-11-6-2-1-3-7-11/h1-3,6-7,10H,4-5,8-9H2/t10-/m1/s1 |
| InChIKey | WXNSMFHLPMUGQO-SNVBAGLBSA-N |
| XLogP | 2.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |