C14H22N5O3+ — CID 78174372
7-(2-hydroxy-3-pyrrolidin-1-ylpropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 78174372) has the molecular formula C14H22N5O3+ and a molecular weight of 308.36 g/mol. Its IUPAC name is 7-(2-hydroxy-3-pyrrolidin-1-ylpropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-(2-hydroxy-3-pyrrolidin-1-ylpropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78174372 |
| Molecular Formula | C14H22N5O3+ |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 7-(2-hydroxy-3-pyrrolidin-1-ylpropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC=[N+]2CC(O)CN2CCCC2)N(C)C1=O |
| InChI | InChI=1S/C14H22N5O3/c1-16-12-11(13(21)17(2)14(16)22)19(9-15-12)8-10(20)7-18-5-3-4-6-18/h9-11,20H,3-8H2,1-2H3/q+1 |
| InChIKey | CJBCBFAEMFTFDZ-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|