C17H23ClO3 — CID 7817800
[(1S)-2-oxocyclohexyl] (5S,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 7817800) has the molecular formula C17H23ClO3 and a molecular weight of 310.82 g/mol. Its IUPAC name is [(1S)-2-oxocyclohexyl] (5S,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | [(1S)-2-oxocyclohexyl] (5S,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 7817800 |
| Molecular Formula | C17H23ClO3 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | [(1S)-2-oxocyclohexyl] (5S,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | O=C1CCCC[C@@H]1OC(=O)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C17H23ClO3/c18-17-8-11-5-12(9-17)7-16(6-11,10-17)15(20)21-14-4-2-1-3-13(14)19/h11-12,14H,1-10H2/t11-,12+,14-,16?,17?/m0/s1 |
| InChIKey | NCPNQOCOYGBEAD-AYZSHTAMSA-N |
| XLogP | 3.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|