C10H23NO9 — CID 78178362
2-(2-hydroxyethylamino)ethanol;2,3,4,5,6-pentahydroxyhexanoic acid (PubChem CID 78178362) has the molecular formula C10H23NO9 and a molecular weight of 301.29 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)ethanol;2,3,4,5,6-pentahydroxyhexanoic acid.
| Compound Name | 2-(2-hydroxyethylamino)ethanol;2,3,4,5,6-pentahydroxyhexanoic acid |
|---|---|
| PubChem CID | 78178362 |
| Molecular Formula | C10H23NO9 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-(2-hydroxyethylamino)ethanol;2,3,4,5,6-pentahydroxyhexanoic acid |
| SMILES | O=C(O)C(O)C(O)C(O)C(O)CO.OCCNCCO |
| InChI | InChI=1S/C6H12O7.C4H11NO2/c7-1-2(8)3(9)4(10)5(11)6(12)13;6-3-1-5-2-4-7/h2-5,7-11H,1H2,(H,12,13);5-7H,1-4H2 |
| InChIKey | RLPKEZKBJIBKAG-UHFFFAOYSA-N |
| XLogP | -4.93 |
| TPSA | 190.94 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | -4.93 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|