C11H7N3O2 — CID 78179440
3-methylpyrimido[4,5-b]indole-2,4-dione (PubChem CID 78179440) has the molecular formula C11H7N3O2 and a molecular weight of 213.20 g/mol. Its IUPAC name is 3-methylpyrimido[4,5-b]indole-2,4-dione.
| Compound Name | 3-methylpyrimido[4,5-b]indole-2,4-dione |
|---|---|
| PubChem CID | 78179440 |
| Molecular Formula | C11H7N3O2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 3-methylpyrimido[4,5-b]indole-2,4-dione |
| SMILES | CN1C(=O)N=C2N=c3ccccc3=C2C1=O |
| InChI | InChI=1S/C11H7N3O2/c1-14-10(15)8-6-4-2-3-5-7(6)12-9(8)13-11(14)16/h2-5H,1H3 |
| InChIKey | IURFJACDHZVWSC-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |