C15H24N5O5+ — CID 78202784
7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(morpholin-4-ylmethyl)-5H-purin-7-ium-2,6-dione (PubChem CID 78202784) has the molecular formula C15H24N5O5+ and a molecular weight of 354.39 g/mol. Its IUPAC name is 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(morpholin-4-ylmethyl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(morpholin-4-ylmethyl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78202784 |
| Molecular Formula | C15H24N5O5+ |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 7-(2,3-dihydroxypropyl)-1,3-dimethyl-8-(morpholin-4-ylmethyl)-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(CN3CCOCC3)=[N+]2CC(O)CO)N(C)C1=O |
| InChI | InChI=1S/C15H24N5O5/c1-17-13-12(14(23)18(2)15(17)24)20(7-10(22)9-21)11(16-13)8-19-3-5-25-6-4-19/h10,12,21-22H,3-9H2,1-2H3/q+1 |
| InChIKey | XOOZLLGYAUEDTC-UHFFFAOYSA-N |
| XLogP | -2.61 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|