C13H20N6O2 — CID 78203619
3-methyl-8-piperazin-1-yl-7-prop-2-enyl-4,5-dihydropurine-2,6-dione (PubChem CID 78203619) has the molecular formula C13H20N6O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 3-methyl-8-piperazin-1-yl-7-prop-2-enyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 3-methyl-8-piperazin-1-yl-7-prop-2-enyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78203619 |
| Molecular Formula | C13H20N6O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 3-methyl-8-piperazin-1-yl-7-prop-2-enyl-4,5-dihydropurine-2,6-dione |
| SMILES | C=CCN1C(N2CCNCC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C13H20N6O2/c1-3-6-19-9-10(17(2)13(21)16-11(9)20)15-12(19)18-7-4-14-5-8-18/h3,9-10,14H,1,4-8H2,2H3,(H,16,20,21) |
| InChIKey | UXAOEWGWBAHJNA-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|