C8H12N2O — CID 79405150
3-butyl-5-ethenyl-1,2,4-oxadiazole (PubChem CID 79405150) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 3-butyl-5-ethenyl-1,2,4-oxadiazole.
| Compound Name | 3-butyl-5-ethenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 79405150 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 3-butyl-5-ethenyl-1,2,4-oxadiazole |
| SMILES | C=Cc1nc(CCCC)no1 |
| InChI | InChI=1S/C8H12N2O/c1-3-5-6-7-9-8(4-2)11-10-7/h4H,2-3,5-6H2,1H3 |
| InChIKey | VIEYQVPACXIQOJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |