C13H12N2OS — CID 7944210
(E)-N-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylprop-2-enamide (PubChem CID 7944210) has the molecular formula C13H12N2OS and a molecular weight of 244.32 g/mol. Its IUPAC name is (E)-N-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 7944210 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (E)-N-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylprop-2-enamide |
| SMILES | Cn1ccs/c1=N/C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C13H12N2OS/c1-15-9-10-17-13(15)14-12(16)8-7-11-5-3-2-4-6-11/h2-10H,1H3/b8-7+,14-13+ |
| InChIKey | MTFWHCFKXKNLAF-SCCLZRITSA-N |
| XLogP | 2.23 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|