C10H14Cl2N+ — CID 7959872
(2,6-dichlorophenyl)methyl-propylazanium (PubChem CID 7959872) has the molecular formula C10H14Cl2N+ and a molecular weight of 219.14 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl-propylazanium.
| Compound Name | (2,6-dichlorophenyl)methyl-propylazanium |
|---|---|
| PubChem CID | 7959872 |
| Molecular Formula | C10H14Cl2N+ |
| Molecular Weight | 219.14 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | (2,6-dichlorophenyl)methyl-propylazanium |
| SMILES | CCC[NH2+]Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H13Cl2N/c1-2-6-13-7-8-9(11)4-3-5-10(8)12/h3-5,13H,2,6-7H2,1H3/p+1 |
| InChIKey | RWUWXULYALWAGV-UHFFFAOYSA-O |
| XLogP | 2.47 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.14 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|