C10H12N4OS2 — CID 80625048
[5-[(2-methoxyphenyl)sulfanylmethyl]-1,3,4-thiadiazol-2-yl]hydrazine (PubChem CID 80625048) has the molecular formula C10H12N4OS2 and a molecular weight of 268.37 g/mol. Its IUPAC name is [5-[(2-methoxyphenyl)sulfanylmethyl]-1,3,4-thiadiazol-2-yl]hydrazine.
| Compound Name | [5-[(2-methoxyphenyl)sulfanylmethyl]-1,3,4-thiadiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 80625048 |
| Molecular Formula | C10H12N4OS2 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | [5-[(2-methoxyphenyl)sulfanylmethyl]-1,3,4-thiadiazol-2-yl]hydrazine |
| SMILES | COc1ccccc1SCc1nnc(NN)s1 |
| InChI | InChI=1S/C10H12N4OS2/c1-15-7-4-2-3-5-8(7)16-6-9-13-14-10(12-11)17-9/h2-5H,6,11H2,1H3,(H,12,14) |
| InChIKey | WZWYLTZDSBDBEQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|