C17H16OS2 — CID 80733768
(4-butylphenyl)-thieno[3,2-b]thiophen-5-ylmethanone (PubChem CID 80733768) has the molecular formula C17H16OS2 and a molecular weight of 300.45 g/mol. Its IUPAC name is (4-butylphenyl)-thieno[3,2-b]thiophen-5-ylmethanone.
| Compound Name | (4-butylphenyl)-thieno[3,2-b]thiophen-5-ylmethanone |
|---|---|
| PubChem CID | 80733768 |
| Molecular Formula | C17H16OS2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | (4-butylphenyl)-thieno[3,2-b]thiophen-5-ylmethanone |
| SMILES | CCCCc1ccc(C(=O)c2cc3sccc3s2)cc1 |
| InChI | InChI=1S/C17H16OS2/c1-2-3-4-12-5-7-13(8-6-12)17(18)16-11-15-14(20-16)9-10-19-15/h5-11H,2-4H2,1H3 |
| InChIKey | WVMSLUNWGJSZHP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |