C11H21N3OS — CID 81190010
1-[(1,3-diethylpyrazol-5-yl)methylsulfinyl]propan-2-amine (PubChem CID 81190010) has the molecular formula C11H21N3OS and a molecular weight of 243.38 g/mol. Its IUPAC name is 1-[(1,3-diethylpyrazol-5-yl)methylsulfinyl]propan-2-amine.
| Compound Name | 1-[(1,3-diethylpyrazol-5-yl)methylsulfinyl]propan-2-amine |
|---|---|
| PubChem CID | 81190010 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 1-[(1,3-diethylpyrazol-5-yl)methylsulfinyl]propan-2-amine |
| SMILES | CCc1cc(CS(=O)CC(C)N)n(CC)n1 |
| InChI | InChI=1S/C11H21N3OS/c1-4-10-6-11(14(5-2)13-10)8-16(15)7-9(3)12/h6,9H,4-5,7-8,12H2,1-3H3 |
| InChIKey | XVDTZMQBNFNCAJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |