C14H15N3OS — CID 82104875
5-(2-amino-1,3-thiazol-4-yl)-3,3,7-trimethyl-1H-indol-2-one (PubChem CID 82104875) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is 5-(2-amino-1,3-thiazol-4-yl)-3,3,7-trimethyl-1H-indol-2-one.
| Compound Name | 5-(2-amino-1,3-thiazol-4-yl)-3,3,7-trimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 82104875 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 5-(2-amino-1,3-thiazol-4-yl)-3,3,7-trimethyl-1H-indol-2-one |
| SMILES | Cc1cc(-c2csc(N)n2)cc2c1NC(=O)C2(C)C |
| InChI | InChI=1S/C14H15N3OS/c1-7-4-8(10-6-19-13(15)16-10)5-9-11(7)17-12(18)14(9,2)3/h4-6H,1-3H3,(H2,15,16)(H,17,18) |
| InChIKey | MWJYOWNUARCCKY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |