C14H14ClN3O2 — CID 82346977
4-[4-(3-chlorophenyl)-2,6-dioxopiperazin-1-yl]butanenitrile (PubChem CID 82346977) has the molecular formula C14H14ClN3O2 and a molecular weight of 291.74 g/mol. Its IUPAC name is 4-[4-(3-chlorophenyl)-2,6-dioxopiperazin-1-yl]butanenitrile.
| Compound Name | 4-[4-(3-chlorophenyl)-2,6-dioxopiperazin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 82346977 |
| Molecular Formula | C14H14ClN3O2 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 4-[4-(3-chlorophenyl)-2,6-dioxopiperazin-1-yl]butanenitrile |
| SMILES | N#CCCCN1C(=O)CN(c2cccc(Cl)c2)CC1=O |
| InChI | InChI=1S/C14H14ClN3O2/c15-11-4-3-5-12(8-11)17-9-13(19)18(14(20)10-17)7-2-1-6-16/h3-5,8H,1-2,7,9-10H2 |
| InChIKey | IQMUPZKSUFYPKB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|