About 2-(5,6-dihydro-4H-thieno[3,4-c]pyrrol-3-yl)ethanamine
2-(5,6-dihydro-4H-thieno[3,4-c]pyrrol-3-yl)ethanamine (PubChem CID 82413103) has the molecular formula C8H12N2S
and a molecular weight of 168.26 g/mol. Its IUPAC name is 2-(5,6-dihydro-4H-thieno[3,4-c]pyrrol-3-yl)ethanamine.
Analyze 2-(5,6-dihydro-4H-thieno[3,4-c]pyrrol-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,6-dihydro-4H-thieno[3,4-c]pyrrol-3-yl)ethanamine?
The IUPAC name of 2-(5,6-dihydro-4H-thieno[3,4-c]pyrrol-3-yl)ethanamine (CID 82413103) is 2-(5,6-dihydro-4H-thieno[3,4-c]pyrrol-3-yl)ethanamine.
What is the SMILES notation for 2-(5,6-dihydro-4H-thieno[3,4-c]pyrrol-3-yl)ethanamine?
The canonical SMILES for 2-(5,6-dihydro-4H-thieno[3,4-c]pyrrol-3-yl)ethanamine is NCCc1scc2c1CNC2.
What is the InChIKey of 2-(5,6-dihydro-4H-thieno[3,4-c]pyrrol-3-yl)ethanamine?
The InChIKey is ARGLLMROFIHWIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2S/c9-2-1-8-7-4-10-3-6(7)5-11-8/h5,10H,1-4,9H2.
What are the key properties of 2-(5,6-dihydro-4H-thieno[3,4-c]pyrrol-3-yl)ethanamine?
2-(5,6-dihydro-4H-thieno[3,4-c]pyrrol-3-yl)ethanamine has a molecular weight of 168.26 g/mol, XLogP of 0.85, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6-dihydro-4H-thieno[3,4-c]pyrrol-3-yl)ethanamine is sourced from PubChem (CID 82413103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).