C9H11ClF3N3O2 — CID 82461230
2-[2-[[4-chloro-6-(trifluoromethyl)pyrimidin-2-yl]amino]ethoxy]ethanol (PubChem CID 82461230) has the molecular formula C9H11ClF3N3O2 and a molecular weight of 285.65 g/mol. Its IUPAC name is 2-[2-[[4-chloro-6-(trifluoromethyl)pyrimidin-2-yl]amino]ethoxy]ethanol.
| Compound Name | 2-[2-[[4-chloro-6-(trifluoromethyl)pyrimidin-2-yl]amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 82461230 |
| Molecular Formula | C9H11ClF3N3O2 |
| Molecular Weight | 285.65 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 2-[2-[[4-chloro-6-(trifluoromethyl)pyrimidin-2-yl]amino]ethoxy]ethanol |
| SMILES | OCCOCCNc1nc(Cl)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H11ClF3N3O2/c10-7-5-6(9(11,12)13)15-8(16-7)14-1-3-18-4-2-17/h5,17H,1-4H2,(H,14,15,16) |
| InChIKey | GIEOLUPXUUPQHC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.65 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|