C18H16O2 — CID 82578838
(2Z)-2-(1,3,5-trimethylfluoren-9-ylidene)acetic acid (PubChem CID 82578838) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is (2Z)-2-(1,3,5-trimethylfluoren-9-ylidene)acetic acid.
| Compound Name | (2Z)-2-(1,3,5-trimethylfluoren-9-ylidene)acetic acid |
|---|---|
| PubChem CID | 82578838 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (2Z)-2-(1,3,5-trimethylfluoren-9-ylidene)acetic acid |
| SMILES | Cc1cc(C)c2c(c1)-c1c(C)cccc1/C2=C/C(=O)O |
| InChI | InChI=1S/C18H16O2/c1-10-7-12(3)18-14(9-16(19)20)13-6-4-5-11(2)17(13)15(18)8-10/h4-9H,1-3H3,(H,19,20)/b14-9- |
| InChIKey | PONDURICTZBRIB-ZROIWOOFSA-N |
| XLogP | 4.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|