C8H8BrClO2S — CID 82775617
2-(4-bromothiophen-2-yl)-4-(chloromethyl)-1,3-dioxolane (PubChem CID 82775617) has the molecular formula C8H8BrClO2S and a molecular weight of 283.57 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-4-(chloromethyl)-1,3-dioxolane.
| Compound Name | 2-(4-bromothiophen-2-yl)-4-(chloromethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 82775617 |
| Molecular Formula | C8H8BrClO2S |
| Molecular Weight | 283.57 g/mol |
| Exact Mass | 281.91 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-4-(chloromethyl)-1,3-dioxolane |
| SMILES | ClCC1COC(c2cc(Br)cs2)O1 |
| InChI | InChI=1S/C8H8BrClO2S/c9-5-1-7(13-4-5)8-11-3-6(2-10)12-8/h1,4,6,8H,2-3H2 |
| InChIKey | DVWHFVWPQRSOGF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|