C8H10ClN3 — CID 83482820
5-chloro-4-(2-isocyanoethyl)-1,3-dimethylpyrazole (PubChem CID 83482820) has the molecular formula C8H10ClN3 and a molecular weight of 183.64 g/mol. Its IUPAC name is 5-chloro-4-(2-isocyanoethyl)-1,3-dimethylpyrazole.
| Compound Name | 5-chloro-4-(2-isocyanoethyl)-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 83482820 |
| Molecular Formula | C8H10ClN3 |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 5-chloro-4-(2-isocyanoethyl)-1,3-dimethylpyrazole |
| SMILES | [C-]#[N+]CCc1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C8H10ClN3/c1-6-7(4-5-10-2)8(9)12(3)11-6/h4-5H2,1,3H3 |
| InChIKey | RRDUPAVOOKGHQI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 22.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|