C9H11NO — CID 83872441
7-methyl-2,3-dihydro-1H-indol-4-ol (PubChem CID 83872441) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 7-methyl-2,3-dihydro-1H-indol-4-ol.
| Compound Name | 7-methyl-2,3-dihydro-1H-indol-4-ol |
|---|---|
| PubChem CID | 83872441 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 7-methyl-2,3-dihydro-1H-indol-4-ol |
| SMILES | Cc1ccc(O)c2c1NCC2 |
| InChI | InChI=1S/C9H11NO/c1-6-2-3-8(11)7-4-5-10-9(6)7/h2-3,10-11H,4-5H2,1H3 |
| InChIKey | JEYBBBWNIABSGK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |