C8H10N2O — CID 84649416
7-amino-2,3-dihydro-1H-indol-6-ol (PubChem CID 84649416) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 7-amino-2,3-dihydro-1H-indol-6-ol.
| Compound Name | 7-amino-2,3-dihydro-1H-indol-6-ol |
|---|---|
| PubChem CID | 84649416 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 7-amino-2,3-dihydro-1H-indol-6-ol |
| SMILES | Nc1c(O)ccc2c1NCC2 |
| InChI | InChI=1S/C8H10N2O/c9-7-6(11)2-1-5-3-4-10-8(5)7/h1-2,10-11H,3-4,9H2 |
| InChIKey | GIPFILNQWHARKV-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|