2-bromo-4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid

C9H7BrO3S — CID 83920526

IUPAC2-bromo-4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid
SMILESO=C1CC(C(=O)O)Cc2sc(Br)cc21
InChIInChI=1S/C9H7BrO3S/c10-8-3-5-6(11)1-4(9(12)13)2-7(5)14-8/h3-4H,1-2H2,(H,12,13)
InChIKeyOHKBBFPFCMWYBY-UHFFFAOYSA-N
MW275.12 g/mol
LogP2.34
Rot. Bonds1

About 2-bromo-4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid

2-bromo-4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid (PubChem CID 83920526) has the molecular formula C9H7BrO3S and a molecular weight of 275.12 g/mol. Its IUPAC name is 2-bromo-4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid.

Molecular Properties

Compound Name2-bromo-4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid
PubChem CID83920526
Molecular FormulaC9H7BrO3S
Molecular Weight275.12 g/mol
Exact Mass273.93
IUPAC Name2-bromo-4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid
SMILESO=C1CC(C(=O)O)Cc2sc(Br)cc21
InChIInChI=1S/C9H7BrO3S/c10-8-3-5-6(11)1-4(9(12)13)2-7(5)14-8/h3-4H,1-2H2,(H,12,13)
InChIKeyOHKBBFPFCMWYBY-UHFFFAOYSA-N
XLogP2.34
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.12
LogP ≤ 52.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-bromo-4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-bromo-4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid?
The IUPAC name of 2-bromo-4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid (CID 83920526) is 2-bromo-4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid.
What is the SMILES notation for 2-bromo-4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid?
The canonical SMILES for 2-bromo-4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid is O=C1CC(C(=O)O)Cc2sc(Br)cc21.
What is the InChIKey of 2-bromo-4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid?
The InChIKey is OHKBBFPFCMWYBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrO3S/c10-8-3-5-6(11)1-4(9(12)13)2-7(5)14-8/h3-4H,1-2H2,(H,12,13).
What are the key properties of 2-bromo-4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid?
2-bromo-4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid has a molecular weight of 275.12 g/mol, XLogP of 2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid is sourced from PubChem (CID 83920526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).