C33H44FO11P — CID 85174942
[3,4-bis(2,2-dimethylpropanoyloxy)-6-diphenoxyphosphoryloxy-5-fluorooxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 85174942) has the molecular formula C33H44FO11P and a molecular weight of 666.68 g/mol. Its IUPAC name is [3,4-bis(2,2-dimethylpropanoyloxy)-6-diphenoxyphosphoryloxy-5-fluorooxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [3,4-bis(2,2-dimethylpropanoyloxy)-6-diphenoxyphosphoryloxy-5-fluorooxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 85174942 |
| Molecular Formula | C33H44FO11P |
| Molecular Weight | 666.68 g/mol |
| Exact Mass | 666.26 |
| IUPAC Name | [3,4-bis(2,2-dimethylpropanoyloxy)-6-diphenoxyphosphoryloxy-5-fluorooxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC1OC(OP(=O)(Oc2ccccc2)Oc2ccccc2)C(F)C(OC(=O)C(C)(C)C)C1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C33H44FO11P/c1-31(2,3)28(35)39-20-23-25(41-29(36)32(4,5)6)26(42-30(37)33(7,8)9)24(34)27(40-23)45-46(38,43-21-16-12-10-13-17-21)44-22-18-14-11-15-19-22/h10-19,23-27H,20H2,1-9H3 |
| InChIKey | BHTKPVMVIKGENE-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.68 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|