C14H26O4 — CID 85433438
3-butyl-5,6-bis(methoxymethyl)cyclohex-3-ene-1,2-diol (PubChem CID 85433438) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is 3-butyl-5,6-bis(methoxymethyl)cyclohex-3-ene-1,2-diol.
| Compound Name | 3-butyl-5,6-bis(methoxymethyl)cyclohex-3-ene-1,2-diol |
|---|---|
| PubChem CID | 85433438 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 3-butyl-5,6-bis(methoxymethyl)cyclohex-3-ene-1,2-diol |
| SMILES | CCCCC1=CC(COC)C(COC)C(O)C1O |
| InChI | InChI=1S/C14H26O4/c1-4-5-6-10-7-11(8-17-2)12(9-18-3)14(16)13(10)15/h7,11-16H,4-6,8-9H2,1-3H3 |
| InChIKey | TUVGKNNUUIHKAG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|