C14H18ClN3O3S3 — CID 8562276
1-[2-(4-chlorophenyl)sulfanylethyl]-3-[[(3S)-1,1-dioxothiolane-3-carbonyl]amino]thiourea (PubChem CID 8562276) has the molecular formula C14H18ClN3O3S3 and a molecular weight of 407.97 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-3-[[(3S)-1,1-dioxothiolane-3-carbonyl]amino]thiourea.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-[[(3S)-1,1-dioxothiolane-3-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 8562276 |
| Molecular Formula | C14H18ClN3O3S3 |
| Molecular Weight | 407.97 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-[[(3S)-1,1-dioxothiolane-3-carbonyl]amino]thiourea |
| SMILES | O=C(NNC(=S)NCCSc1ccc(Cl)cc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H18ClN3O3S3/c15-11-1-3-12(4-2-11)23-7-6-16-14(22)18-17-13(19)10-5-8-24(20,21)9-10/h1-4,10H,5-9H2,(H,17,19)(H2,16,18,22)/t10-/m1/s1 |
| InChIKey | RCBZYGZUXRDPRJ-SNVBAGLBSA-N |
| XLogP | 1.36 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.97 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|