About CID 86088537
CID 86088537 (PubChem CID 86088537) has the molecular formula C14H14In
and a molecular weight of 297.08 g/mol.
Molecular Properties
| Compound Name | CID 86088537 |
| PubChem CID | 86088537 |
| Molecular Formula | C14H14In |
| Molecular Weight | 297.08 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | — |
| SMILES | Cc1ccc([In]c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/2C7H7.In/c2*1-7-5-3-2-4-6-7;/h2*3-6H,1H3; |
| InChIKey | OOJCWFIRZOTYDH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.08 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 86088537 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 86088537?
The IUPAC name of CID 86088537 (CID 86088537) is not available.
What is the SMILES notation for CID 86088537?
The canonical SMILES for CID 86088537 is Cc1ccc([In]c2ccc(C)cc2)cc1.
What is the InChIKey of CID 86088537?
The InChIKey is OOJCWFIRZOTYDH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H7.In/c2*1-7-5-3-2-4-6-7;/h2*3-6H,1H3;.
What are the key properties of CID 86088537?
CID 86088537 has a molecular weight of 297.08 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 86088537 is sourced from PubChem (CID 86088537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).