C35H38N6O4 — CID 86281961
1-[5-[[7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]-2,3-dihydroindol-1-yl]-2-(2-methyl-1H-indol-3-yl)ethanone (PubChem CID 86281961) has the molecular formula C35H38N6O4 and a molecular weight of 606.73 g/mol. Its IUPAC name is 1-[5-[[7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]-2,3-dihydroindol-1-yl]-2-(2-methyl-1H-indol-3-yl)ethanone.
| Compound Name | 1-[5-[[7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]-2,3-dihydroindol-1-yl]-2-(2-methyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 86281961 |
| Molecular Formula | C35H38N6O4 |
| Molecular Weight | 606.73 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | 1-[5-[[7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]-2,3-dihydroindol-1-yl]-2-(2-methyl-1H-indol-3-yl)ethanone |
| SMILES | COc1cc2ncnc(Nc3ccc4c(c3)CCN4C(=O)Cc3c(C)[nH]c4ccccc34)c2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C35H38N6O4/c1-23-27(26-6-3-4-7-29(26)38-23)20-34(42)41-12-10-24-18-25(8-9-31(24)41)39-35-28-19-33(32(43-2)21-30(28)36-22-37-35)45-15-5-11-40-13-16-44-17-14-40/h3-4,6-9,18-19,21-22,38H,5,10-17,20H2,1-2H3,(H,36,37,39) |
| InChIKey | MFPJPTQYGKELCP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 104.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.73 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|