C31H44BFN2O5 — CID 86282476
N'-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylpentan-3-yl]-2-fluoro-4-(methoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide (PubChem CID 86282476) has the molecular formula C31H44BFN2O5 and a molecular weight of 554.51 g/mol. Its IUPAC name is N'-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylpentan-3-yl]-2-fluoro-4-(methoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide.
| Compound Name | N'-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylpentan-3-yl]-2-fluoro-4-(methoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 86282476 |
| Molecular Formula | C31H44BFN2O5 |
| Molecular Weight | 554.51 g/mol |
| Exact Mass | 554.33 |
| IUPAC Name | N'-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylpentan-3-yl]-2-fluoro-4-(methoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide |
| SMILES | CC[C@@H](N(NC(=O)c1ccc(COC)c(B2OC(C)(C)C(C)(C)O2)c1F)C(=O)c1cc(C)cc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C31H44BFN2O5/c1-12-24(29(4,5)6)35(28(37)22-16-19(2)15-20(3)17-22)34-27(36)23-14-13-21(18-38-11)25(26(23)33)32-39-30(7,8)31(9,10)40-32/h13-17,24H,12,18H2,1-11H3,(H,34,36)/t24-/m1/s1 |
| InChIKey | XHZJSCMYPKUFJD-XMMPIXPASA-N |
| XLogP | 5.50 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|