C18H20N6O3S — CID 86345973
4-morpholin-4-yl-N-[(E)-(4-nitrophenyl)methylideneamino]-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-amine (PubChem CID 86345973) has the molecular formula C18H20N6O3S and a molecular weight of 400.46 g/mol. Its IUPAC name is 4-morpholin-4-yl-N-[(E)-(4-nitrophenyl)methylideneamino]-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-amine.
| Compound Name | 4-morpholin-4-yl-N-[(E)-(4-nitrophenyl)methylideneamino]-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 86345973 |
| Molecular Formula | C18H20N6O3S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 4-morpholin-4-yl-N-[(E)-(4-nitrophenyl)methylideneamino]-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(/C=N/Nc2nc3c(c(N4CCOCC4)n2)CSCC3)cc1 |
| InChI | InChI=1S/C18H20N6O3S/c25-24(26)14-3-1-13(2-4-14)11-19-22-18-20-16-5-10-28-12-15(16)17(21-18)23-6-8-27-9-7-23/h1-4,11H,5-10,12H2,(H,20,21,22)/b19-11+ |
| InChIKey | SSRYFFYQUPDFTD-YBFXNURJSA-N |
| XLogP | 2.46 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|