C21H27N5O6S — CID 118724052
4-morpholin-4-yl-6,6-dioxo-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-amine (PubChem CID 118724052) has the molecular formula C21H27N5O6S and a molecular weight of 477.54 g/mol. Its IUPAC name is 4-morpholin-4-yl-6,6-dioxo-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-amine.
| Compound Name | 4-morpholin-4-yl-6,6-dioxo-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 118724052 |
| Molecular Formula | C21H27N5O6S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 4-morpholin-4-yl-6,6-dioxo-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-amine |
| SMILES | COc1cc(/C=N/Nc2nc3c(c(N4CCOCC4)n2)CS(=O)(=O)CC3)cc(OC)c1OC |
| InChI | InChI=1S/C21H27N5O6S/c1-29-17-10-14(11-18(30-2)19(17)31-3)12-22-25-21-23-16-4-9-33(27,28)13-15(16)20(24-21)26-5-7-32-8-6-26/h10-12H,4-9,13H2,1-3H3,(H,23,24,25)/b22-12+ |
| InChIKey | YPFULBJNILNBNG-WSDLNYQXSA-N |
| XLogP | 1.26 |
| TPSA | 124.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|